![[ICO]](/icons/blank.gif) | Name | Size |
![[DIR]](/icons/back.gif) | Parent Directory | - |
![[VID]](/icons/movie.gif) | Am I creating karma even when my reaction to everything is optimistic.mp4 | 21M |
![[VID]](/icons/movie.gif) | Can I become free by negating karma.mp4 | 26M |
![[VID]](/icons/movie.gif) | Can I live without creating more karma.mp4 | 8.4M |
![[VID]](/icons/movie.gif) | Can my karma come in the way of my spiritual growth.mp4 | 7.0M |
![[VID]](/icons/movie.gif) | Does karma play a role in expanding one's consciousness.mp4 | 20M |
![[VID]](/icons/movie.gif) | Does my duty towards others increase my karma.mp4 | 18M |
![[VID]](/icons/movie.gif) | Do our tendencies take time to change.mp4 | 24M |
![[VID]](/icons/movie.gif) | Do we live from moment to moment.mp4 | 20M |
![[VID]](/icons/movie.gif) | How can I break away from compulsive patterns in my life.mp4 | 28M |
![[VID]](/icons/movie.gif) | How can I stop suffering.mp4 | 26M |
![[VID]](/icons/movie.gif) | How can we accept death.mp4 | 17M |
![[VID]](/icons/movie.gif) | How can we experience life without accumulating karma.mp4 | 7.1M |
![[VID]](/icons/movie.gif) | How can we make the most of what you are teaching us here.mp4 | 30M |
![[VID]](/icons/movie.gif) | How can we re-write our karma.mp4 | 18M |
![[VID]](/icons/movie.gif) | How do I choose not to suffer when there is pain.mp4 | 5.7M |
![[VID]](/icons/movie.gif) | How do I go beyond the bondages of the body, especially when I am sick or injured.mp4 | 70M |
![[VID]](/icons/movie.gif) | Is getting a disease a consequence of karma.mp4 | 24M |
![[VID]](/icons/movie.gif) | Is it my karma that I am prone to accidents and injuries.mp4 | 16M |
![[VID]](/icons/movie.gif) | Is it possible to dissolve karma.mp4 | 11M |
![[VID]](/icons/movie.gif) | Is it true that good things happen only to good people.mp4 | 30M |
![[VID]](/icons/movie.gif) | Is karma a consequence of our actions and Do we build karma through thoughts.mp4 | 32M |
![[VID]](/icons/movie.gif) | Is mental disability connected to karma.mp4 | 32M |
![[VID]](/icons/movie.gif) | Isn't living in the moment relative.mp4 | 14M |
![[VID]](/icons/movie.gif) | Is philosophy helpful in becoming more aware.mp4 | 19M |
![[VID]](/icons/movie.gif) | Is there such a thing as past lives.mp4 | 18M |
![[VID]](/icons/movie.gif) | Is there such a thing as positive and negative karma.mp4 | 8.3M |
![[VID]](/icons/movie.gif) | Is wealth and poverty decided by karma.mp4 | 9.0M |
![[VID]](/icons/movie.gif) | People always talk about karma in terms of reward and punishment, is this true.mp4 | 28M |
![[VID]](/icons/movie.gif) | What happens to us after we die.mp4 | 36M |
![[VID]](/icons/movie.gif) | What is the difference between karma and samskara.mp4 | 39M |
![[VID]](/icons/movie.gif) | What kind of food should I eat.mp4 | 235M |
![[VID]](/icons/movie.gif) | Who decides the course of our lives.mp4 | 42M |