![[ICO]](/icons/blank.gif) | Name | Size |
|---|
![[DIR]](/icons/back.gif) | Parent Directory | - |
![[DIR]](/icons/dir.png) | Pornography and Prostitution/ | - |
| Sins of The Tobacco and Alcohol Industries/ | - |
![[PDF]](/icons/pdf.png) | Bradbury - The Dynamics of Child Poverty in Industrialized Countries (2001).pdf | 2.0M |
| Brady - Rich Democracies, Poor People; How Politics Explain Poverty (2009).pdf | 1.1M |
| Grant - The Dispossessed; Homelessness in America (1986).pdf | 11M |
| Hillman - The Chemical Muse; Drug Use and The Roots of Western Civilization (2008).pdf | 1.1M |
| Landes - The Wealth and Poverty of Nations; Why Some Are So Rich and Some So Poor (1998).pdf | 13M |
| McIntyre - Inter City Kids; Adolescents Confront Life and Violence in an Urban Community (2000).pdf | 1.2M |
| Plant - Risk-takers; Alcohol, Drugs, Sex and Youth (1992).pdf | 1.1M |
